C37H45N7O6S — CID 90005502
N-[4-methyl-2-[4-(2-phenylmethoxyethyl)piperazin-1-yl]quinolin-6-yl]-2-[(1-methylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetamide (PubChem CID 90005502) has the molecular formula C37H45N7O6S and a molecular weight of 715.88 g/mol. Its IUPAC name is N-[4-methyl-2-[4-(2-phenylmethoxyethyl)piperazin-1-yl]quinolin-6-yl]-2-[(1-methylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-[4-methyl-2-[4-(2-phenylmethoxyethyl)piperazin-1-yl]quinolin-6-yl]-2-[(1-methylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 90005502 |
| Molecular Formula | C37H45N7O6S |
| Molecular Weight | 715.88 g/mol |
| Exact Mass | 715.32 |
| IUPAC Name | N-[4-methyl-2-[4-(2-phenylmethoxyethyl)piperazin-1-yl]quinolin-6-yl]-2-[(1-methylpiperidin-4-yl)-(2-nitrophenyl)sulfonylamino]acetamide |
| SMILES | Cc1cc(N2CCN(CCOCc3ccccc3)CC2)nc2ccc(NC(=O)CN(C3CCN(C)CC3)S(=O)(=O)c3ccccc3[N+](=O)[O-])cc12 |
| InChI | InChI=1S/C37H45N7O6S/c1-28-24-36(42-20-18-41(19-21-42)22-23-50-27-29-8-4-3-5-9-29)39-33-13-12-30(25-32(28)33)38-37(45)26-43(31-14-16-40(2)17-15-31)51(48,49)35-11-7-6-10-34(35)44(46)47/h3-13,24-25,31H,14-23,26-27H2,1-2H3,(H,38,45) |
| InChIKey | HNJAYEJJGDQROE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 141.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.88 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|