C24H27N5O3 — CID 46504475
N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-(4-nitrophenyl)acetamide (PubChem CID 46504475) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 46504475 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-2-(4-nitrophenyl)acetamide |
| SMILES | CCN1CCN(c2cc(C)c3cc(NC(=O)Cc4ccc([N+](=O)[O-])cc4)ccc3n2)CC1 |
| InChI | InChI=1S/C24H27N5O3/c1-3-27-10-12-28(13-11-27)23-14-17(2)21-16-19(6-9-22(21)26-23)25-24(30)15-18-4-7-20(8-5-18)29(31)32/h4-9,14,16H,3,10-13,15H2,1-2H3,(H,25,30) |
| InChIKey | FKGQCGFFUXHPNS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|