C24H30N4O6S — CID 169449099
tert-butyl 3-benzyl-7-(2-nitrophenyl)sulfonyl-3,7,9-triazabicyclo[3.3.1]nonane-9-carboxylate (PubChem CID 169449099) has the molecular formula C24H30N4O6S and a molecular weight of 502.59 g/mol. Its IUPAC name is tert-butyl 3-benzyl-7-(2-nitrophenyl)sulfonyl-3,7,9-triazabicyclo[3.3.1]nonane-9-carboxylate.
| Compound Name | tert-butyl 3-benzyl-7-(2-nitrophenyl)sulfonyl-3,7,9-triazabicyclo[3.3.1]nonane-9-carboxylate |
|---|---|
| PubChem CID | 169449099 |
| Molecular Formula | C24H30N4O6S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.19 |
| IUPAC Name | tert-butyl 3-benzyl-7-(2-nitrophenyl)sulfonyl-3,7,9-triazabicyclo[3.3.1]nonane-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CN(Cc3ccccc3)CC1CN(S(=O)(=O)c1ccccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/C24H30N4O6S/c1-24(2,3)34-23(29)27-19-14-25(13-18-9-5-4-6-10-18)15-20(27)17-26(16-19)35(32,33)22-12-8-7-11-21(22)28(30)31/h4-12,19-20H,13-17H2,1-3H3 |
| InChIKey | BREQFTNZDYCOOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|