C15H20N6O6S — CID 118026132
tert-butyl N-[4-azido-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 118026132) has the molecular formula C15H20N6O6S and a molecular weight of 412.43 g/mol. Its IUPAC name is tert-butyl N-[4-azido-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[4-azido-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 118026132 |
| Molecular Formula | C15H20N6O6S |
| Molecular Weight | 412.43 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | tert-butyl N-[4-azido-1-(2-nitrophenyl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1N=[N+]=[N-] |
| InChI | InChI=1S/C15H20N6O6S/c1-15(2,3)27-14(22)17-10-8-20(9-11(10)18-19-16)28(25,26)13-7-5-4-6-12(13)21(23)24/h4-7,10-11H,8-9H2,1-3H3,(H,17,22) |
| InChIKey | AQCPTXGJMZLUTI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|