C18H26N4O7S — CID 67051720
tert-butyl 3-hydroxy-3-[4-(2-nitrophenyl)sulfonylpiperazin-2-yl]azetidine-1-carboxylate (PubChem CID 67051720) has the molecular formula C18H26N4O7S and a molecular weight of 442.49 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-[4-(2-nitrophenyl)sulfonylpiperazin-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-[4-(2-nitrophenyl)sulfonylpiperazin-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 67051720 |
| Molecular Formula | C18H26N4O7S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | tert-butyl 3-hydroxy-3-[4-(2-nitrophenyl)sulfonylpiperazin-2-yl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(C2CN(S(=O)(=O)c3ccccc3[N+](=O)[O-])CCN2)C1 |
| InChI | InChI=1S/C18H26N4O7S/c1-17(2,3)29-16(23)20-11-18(24,12-20)15-10-21(9-8-19-15)30(27,28)14-7-5-4-6-13(14)22(25)26/h4-7,15,19,24H,8-12H2,1-3H3 |
| InChIKey | BVDQFIHSKRFGES-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|