C24H28N4O7S — CID 86700670
tert-butyl (2S,5R)-2-cyano-5-[(2-nitrophenyl)sulfonyl-phenylmethoxyamino]piperidine-1-carboxylate (PubChem CID 86700670) has the molecular formula C24H28N4O7S and a molecular weight of 516.58 g/mol. Its IUPAC name is tert-butyl (2S,5R)-2-cyano-5-[(2-nitrophenyl)sulfonyl-phenylmethoxyamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,5R)-2-cyano-5-[(2-nitrophenyl)sulfonyl-phenylmethoxyamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 86700670 |
| Molecular Formula | C24H28N4O7S |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.17 |
| IUPAC Name | tert-butyl (2S,5R)-2-cyano-5-[(2-nitrophenyl)sulfonyl-phenylmethoxyamino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](N(OCc2ccccc2)S(=O)(=O)c2ccccc2[N+](=O)[O-])CC[C@H]1C#N |
| InChI | InChI=1S/C24H28N4O7S/c1-24(2,3)35-23(29)26-16-20(14-13-19(26)15-25)28(34-17-18-9-5-4-6-10-18)36(32,33)22-12-8-7-11-21(22)27(30)31/h4-12,19-20H,13-14,16-17H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | LMKIFQXKVUSFNI-VQTJNVASSA-N |
| XLogP | 4.01 |
| TPSA | 143.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|