C23H26N4O6S — CID 155072772
2-nitro-N-(7-oxo-6-prop-2-enyl-2,3,4,4a,5,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-3-yl)-N-phenylmethoxybenzenesulfonamide (PubChem CID 155072772) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is 2-nitro-N-(7-oxo-6-prop-2-enyl-2,3,4,4a,5,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-3-yl)-N-phenylmethoxybenzenesulfonamide.
| Compound Name | 2-nitro-N-(7-oxo-6-prop-2-enyl-2,3,4,4a,5,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-3-yl)-N-phenylmethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 155072772 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-nitro-N-(7-oxo-6-prop-2-enyl-2,3,4,4a,5,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-3-yl)-N-phenylmethoxybenzenesulfonamide |
| SMILES | C=CCN1CC2CC(N(OCc3ccccc3)S(=O)(=O)c3ccccc3[N+](=O)[O-])CNC2C1=O |
| InChI | InChI=1S/C23H26N4O6S/c1-2-12-25-15-18-13-19(14-24-22(18)23(25)28)27(33-16-17-8-4-3-5-9-17)34(31,32)21-11-7-6-10-20(21)26(29)30/h2-11,18-19,22,24H,1,12-16H2 |
| InChIKey | SWVOUIWFIAWHDR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|