C18H21N3O3 — CID 134363386
(2S,6S,8R)-9-phenylmethoxy-4-prop-2-enyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione (PubChem CID 134363386) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (2S,6S,8R)-9-phenylmethoxy-4-prop-2-enyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione.
| Compound Name | (2S,6S,8R)-9-phenylmethoxy-4-prop-2-enyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
|---|---|
| PubChem CID | 134363386 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (2S,6S,8R)-9-phenylmethoxy-4-prop-2-enyl-1,4,9-triazatricyclo[6.2.1.02,6]undecane-3,10-dione |
| SMILES | C=CCN1C[C@@H]2C[C@@H]3CN(C(=O)N3OCc3ccccc3)[C@@H]2C1=O |
| InChI | InChI=1S/C18H21N3O3/c1-2-8-19-10-14-9-15-11-20(16(14)17(19)22)18(23)21(15)24-12-13-6-4-3-5-7-13/h2-7,14-16H,1,8-12H2/t14-,15+,16-/m0/s1 |
| InChIKey | BUGMLHINDVQKLW-XHSDSOJGSA-N |
| XLogP | 1.64 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|