C16H19N3O3 — CID 134363411
(2S,7R,9R)-10-phenylmethoxy-1,4,10-triazatricyclo[7.2.1.02,7]dodecane-3,11-dione (PubChem CID 134363411) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is (2S,7R,9R)-10-phenylmethoxy-1,4,10-triazatricyclo[7.2.1.02,7]dodecane-3,11-dione.
| Compound Name | (2S,7R,9R)-10-phenylmethoxy-1,4,10-triazatricyclo[7.2.1.02,7]dodecane-3,11-dione |
|---|---|
| PubChem CID | 134363411 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | (2S,7R,9R)-10-phenylmethoxy-1,4,10-triazatricyclo[7.2.1.02,7]dodecane-3,11-dione |
| SMILES | O=C1NCC[C@@H]2C[C@@H]3CN(C(=O)N3OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C16H19N3O3/c20-15-14-12(6-7-17-15)8-13-9-18(14)16(21)19(13)22-10-11-4-2-1-3-5-11/h1-5,12-14H,6-10H2,(H,17,20)/t12-,13-,14+/m1/s1 |
| InChIKey | JKJDKEDVTRYNMS-MCIONIFRSA-N |
| XLogP | 1.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |