C14H16Cl2N2O2 — CID 146346776
(2S,5R)-2-(dichloromethyl)-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 146346776) has the molecular formula C14H16Cl2N2O2 and a molecular weight of 315.20 g/mol. Its IUPAC name is (2S,5R)-2-(dichloromethyl)-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (2S,5R)-2-(dichloromethyl)-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 146346776 |
| Molecular Formula | C14H16Cl2N2O2 |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | (2S,5R)-2-(dichloromethyl)-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N2C[C@@H](CC[C@H]2C(Cl)Cl)N1OCc1ccccc1 |
| InChI | InChI=1S/C14H16Cl2N2O2/c15-13(16)12-7-6-11-8-17(12)14(19)18(11)20-9-10-4-2-1-3-5-10/h1-5,11-13H,6-9H2/t11-,12+/m1/s1 |
| InChIKey | HPZHOLIWRAVRCI-NEPJUHHUSA-N |
| XLogP | 3.19 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|