C22H25I3N6O4 — CID 159126531
(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile;iodoform;(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile (PubChem CID 159126531) has the molecular formula C22H25I3N6O4 and a molecular weight of 818.19 g/mol. Its IUPAC name is (2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile;iodoform;(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile.
| Compound Name | (2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile;iodoform;(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile |
|---|---|
| PubChem CID | 159126531 |
| Molecular Formula | C22H25I3N6O4 |
| Molecular Weight | 818.19 g/mol |
| Exact Mass | 817.91 |
| IUPAC Name | (2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile;iodoform;(2S,5R)-7-oxo-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octane-2-carbonitrile |
| SMILES | IC(I)I.N#C[C@@H]1CC[C@@H]2CN1C(=O)N2O.N#C[C@@H]1CC[C@@H]2CN1C(=O)N2OCc1ccccc1 |
| InChI | InChI=1S/C14H15N3O2.C7H9N3O2.CHI3/c15-8-12-6-7-13-9-16(12)14(18)17(13)19-10-11-4-2-1-3-5-11;8-3-5-1-2-6-4-9(5)7(11)10(6)12;2-1(3)4/h1-5,12-13H,6-7,9-10H2;5-6,12H,1-2,4H2;1H/t12-,13+;5-,6+;/m00./s1 |
| InChIKey | KGIREMDFXGVITG-XWECNDQASA-N |
| XLogP | 4.65 |
| TPSA | 124.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.19 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|