C27H28N2O2 — CID 175037705
(5R)-2,2-dibenzyl-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one (PubChem CID 175037705) has the molecular formula C27H28N2O2 and a molecular weight of 412.53 g/mol. Its IUPAC name is (5R)-2,2-dibenzyl-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one.
| Compound Name | (5R)-2,2-dibenzyl-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 175037705 |
| Molecular Formula | C27H28N2O2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (5R)-2,2-dibenzyl-6-phenylmethoxy-1,6-diazabicyclo[3.2.1]octan-7-one |
| SMILES | O=C1N(OCc2ccccc2)[C@@H]2CCC(Cc3ccccc3)(Cc3ccccc3)N1C2 |
| InChI | InChI=1S/C27H28N2O2/c30-26-28-20-25(29(26)31-21-24-14-8-3-9-15-24)16-17-27(28,18-22-10-4-1-5-11-22)19-23-12-6-2-7-13-23/h1-15,25H,16-21H2/t25-/m1/s1 |
| InChIKey | JKJXDJMNDWPFHY-RUZDIDTESA-N |
| XLogP | 5.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |