C12H15NO2 — CID 10104396
(3S,4R)-3,4-dimethyl-1-phenylmethoxyazetidin-2-one (PubChem CID 10104396) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3S,4R)-3,4-dimethyl-1-phenylmethoxyazetidin-2-one.
| Compound Name | (3S,4R)-3,4-dimethyl-1-phenylmethoxyazetidin-2-one |
|---|---|
| PubChem CID | 10104396 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3S,4R)-3,4-dimethyl-1-phenylmethoxyazetidin-2-one |
| SMILES | C[C@@H]1C(=O)N(OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C12H15NO2/c1-9-10(2)13(12(9)14)15-8-11-6-4-3-5-7-11/h3-7,9-10H,8H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | FPTZTSKOBGQGJR-VHSXEESVSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |