C13H12ClNO3 — CID 89114116
(1S,4S,5R)-4-chloro-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 89114116) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is (1S,4S,5R)-4-chloro-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1S,4S,5R)-4-chloro-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 89114116 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | (1S,4S,5R)-4-chloro-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | O=C1[C@@H](Cl)[C@H]2C=C[C@H](O2)N1OCc1ccccc1 |
| InChI | InChI=1S/C13H12ClNO3/c14-12-10-6-7-11(18-10)15(13(12)16)17-8-9-4-2-1-3-5-9/h1-7,10-12H,8H2/t10-,11+,12+/m1/s1 |
| InChIKey | QEIIZUNMHFHFBL-WOPDTQHZSA-N |
| XLogP | 1.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|