C30H35BrN2O6 — CID 157326683
2-bromo-2-methyl-N-phenylmethoxypropanamide;4,4-dimethyl-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one;furan (PubChem CID 157326683) has the molecular formula C30H35BrN2O6 and a molecular weight of 599.52 g/mol. Its IUPAC name is 2-bromo-2-methyl-N-phenylmethoxypropanamide;4,4-dimethyl-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one;furan.
| Compound Name | 2-bromo-2-methyl-N-phenylmethoxypropanamide;4,4-dimethyl-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one;furan |
|---|---|
| PubChem CID | 157326683 |
| Molecular Formula | C30H35BrN2O6 |
| Molecular Weight | 599.52 g/mol |
| Exact Mass | 598.17 |
| IUPAC Name | 2-bromo-2-methyl-N-phenylmethoxypropanamide;4,4-dimethyl-2-phenylmethoxy-8-oxa-2-azabicyclo[3.2.1]oct-6-en-3-one;furan |
| SMILES | CC(C)(Br)C(=O)NOCc1ccccc1.CC1(C)C(=O)N(OCc2ccccc2)C2C=CC1O2.c1ccoc1 |
| InChI | InChI=1S/C15H17NO3.C11H14BrNO2.C4H4O/c1-15(2)12-8-9-13(19-12)16(14(15)17)18-10-11-6-4-3-5-7-11;1-11(2,12)10(14)13-15-8-9-6-4-3-5-7-9;1-2-4-5-3-1/h3-9,12-13H,10H2,1-2H3;3-7H,8H2,1-2H3,(H,13,14);1-4H |
| InChIKey | BEUQDEFZSLWAJE-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.52 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|