C31H30N2O4 — CID 10696531
N,2-dibenzyl-N',2-bis(phenylmethoxy)propanediamide (PubChem CID 10696531) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is N,2-dibenzyl-N',2-bis(phenylmethoxy)propanediamide.
| Compound Name | N,2-dibenzyl-N',2-bis(phenylmethoxy)propanediamide |
|---|---|
| PubChem CID | 10696531 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | N,2-dibenzyl-N',2-bis(phenylmethoxy)propanediamide |
| SMILES | O=C(NCc1ccccc1)C(Cc1ccccc1)(OCc1ccccc1)C(=O)NOCc1ccccc1 |
| InChI | InChI=1S/C31H30N2O4/c34-29(32-22-26-15-7-2-8-16-26)31(21-25-13-5-1-6-14-25,36-23-27-17-9-3-10-18-27)30(35)33-37-24-28-19-11-4-12-20-28/h1-20H,21-24H2,(H,32,34)(H,33,35) |
| InChIKey | KBUYNOOQXCQTKA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|