C18H16Cl6N2O2 — CID 175728372
N-benzyl-2,2,2-trichloroacetamide;benzyl 2,2,2-trichloroethanimidate (PubChem CID 175728372) has the molecular formula C18H16Cl6N2O2 and a molecular weight of 505.06 g/mol. Its IUPAC name is N-benzyl-2,2,2-trichloroacetamide;benzyl 2,2,2-trichloroethanimidate.
| Compound Name | N-benzyl-2,2,2-trichloroacetamide;benzyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 175728372 |
| Molecular Formula | C18H16Cl6N2O2 |
| Molecular Weight | 505.06 g/mol |
| Exact Mass | 501.93 |
| IUPAC Name | N-benzyl-2,2,2-trichloroacetamide;benzyl 2,2,2-trichloroethanimidate |
| SMILES | O=C(NCc1ccccc1)C(Cl)(Cl)Cl.[H]/N=C(\OCc1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/2C9H8Cl3NO/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7;10-9(11,12)8(14)13-6-7-4-2-1-3-5-7/h1-5,13H,6H2;1-5H,6H2,(H,13,14)/b13-8-; |
| InChIKey | AUWLDQSRNRIBHR-MGAWDJABSA-N |
| XLogP | 6.22 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|