C9H8Cl3NO2 — CID 89030746
(4-hydroxyphenyl)methyl 2,2,2-trichloroethanimidate (PubChem CID 89030746) has the molecular formula C9H8Cl3NO2 and a molecular weight of 268.53 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl 2,2,2-trichloroethanimidate.
| Compound Name | (4-hydroxyphenyl)methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 89030746 |
| Molecular Formula | C9H8Cl3NO2 |
| Molecular Weight | 268.53 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | (4-hydroxyphenyl)methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(\OCc1ccc(O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H8Cl3NO2/c10-9(11,12)8(13)15-5-6-1-3-7(14)4-2-6/h1-4,13-14H,5H2/b13-8- |
| InChIKey | MEUNLLMUCXLAMG-JYRVWZFOSA-N |
| XLogP | 3.26 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|