C17H16Cl6N2O3 — CID 122372292
[6-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyhex-3-ynyl] 2,2,2-trichloroethanimidate (PubChem CID 122372292) has the molecular formula C17H16Cl6N2O3 and a molecular weight of 509.04 g/mol. Its IUPAC name is [6-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyhex-3-ynyl] 2,2,2-trichloroethanimidate.
| Compound Name | [6-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyhex-3-ynyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 122372292 |
| Molecular Formula | C17H16Cl6N2O3 |
| Molecular Weight | 509.04 g/mol |
| Exact Mass | 505.93 |
| IUPAC Name | [6-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxyhex-3-ynyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCC(C#CCCOCc1ccccc1)O/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H16Cl6N2O3/c18-16(19,20)14(24)27-11-13(28-15(25)17(21,22)23)8-4-5-9-26-10-12-6-2-1-3-7-12/h1-3,6-7,13,24-25H,5,9-11H2/b24-14+,25-15+ |
| InChIKey | GQHKSJKJDCMKRH-KOJZRSEWSA-N |
| XLogP | 5.69 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.04 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|