C16H14Cl6N2O3 — CID 122372291
[5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxypent-3-ynyl] 2,2,2-trichloroethanimidate (PubChem CID 122372291) has the molecular formula C16H14Cl6N2O3 and a molecular weight of 495.02 g/mol. Its IUPAC name is [5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxypent-3-ynyl] 2,2,2-trichloroethanimidate.
| Compound Name | [5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxypent-3-ynyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 122372291 |
| Molecular Formula | C16H14Cl6N2O3 |
| Molecular Weight | 495.02 g/mol |
| Exact Mass | 491.91 |
| IUPAC Name | [5-phenylmethoxy-2-(2,2,2-trichloroethanimidoyl)oxypent-3-ynyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCC(C#CCOCc1ccccc1)O/C(=N/[H])C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H14Cl6N2O3/c17-15(18,19)13(23)26-10-12(27-14(24)16(20,21)22)7-4-8-25-9-11-5-2-1-3-6-11/h1-3,5-6,12,23-24H,8-10H2/b23-13+,24-14+ |
| InChIKey | MKOVMOCIQAZOEA-RNIAWFEPSA-N |
| XLogP | 5.30 |
| TPSA | 75.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.02 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|