C15H11BrCl3NO — CID 69473260
[(4-bromophenyl)-phenylmethyl] 2,2,2-trichloroethanimidate (PubChem CID 69473260) has the molecular formula C15H11BrCl3NO and a molecular weight of 407.52 g/mol. Its IUPAC name is [(4-bromophenyl)-phenylmethyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(4-bromophenyl)-phenylmethyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 69473260 |
| Molecular Formula | C15H11BrCl3NO |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 404.91 |
| IUPAC Name | [(4-bromophenyl)-phenylmethyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC(c1ccccc1)c1ccc(Br)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C15H11BrCl3NO/c16-12-8-6-11(7-9-12)13(10-4-2-1-3-5-10)21-14(20)15(17,18)19/h1-9,13,20H/b20-14+ |
| InChIKey | KDPVKVAPUWTSOM-XSFVSMFZSA-N |
| XLogP | 5.90 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|