About (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium
(S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium (PubChem CID 10873031) has the molecular formula C16H11BrCrO4
and a molecular weight of 399.16 g/mol. Its IUPAC name is (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium.
Molecular Properties
| Compound Name | (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium |
| PubChem CID | 10873031 |
| Molecular Formula | C16H11BrCrO4 |
| Molecular Weight | 399.16 g/mol |
| Exact Mass | 397.92 |
| IUPAC Name | (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium |
| SMILES | O[C@@H](c1ccccc1)c1ccc(Br)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C13H11BrO.3CO.Cr/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;3*1-2;/h1-9,13,15H;;;;/t13-;;;;/m0..../s1 |
| InChIKey | GSMDNMHVBOHOPB-AHJYMZSGSA-N |
| XLogP | 3.42 |
| TPSA | 79.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium?
The IUPAC name of (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium (CID 10873031) is (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium.
What is the SMILES notation for (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium?
The canonical SMILES for (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium is O[C@@H](c1ccccc1)c1ccc(Br)cc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium?
The InChIKey is GSMDNMHVBOHOPB-AHJYMZSGSA-N. The full InChI is InChI=1S/C13H11BrO.3CO.Cr/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10;3*1-2;/h1-9,13,15H;;;;/t13-;;;;/m0..../s1.
What are the key properties of (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium?
(S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium has a molecular weight of 399.16 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(4-bromophenyl)-phenylmethanol;carbon monoxide;chromium is sourced from PubChem (CID 10873031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).