C22H16BrN3O — CID 121456194
(4-bromophenyl)-(4,6-diphenyl-1,3,5-triazin-2-yl)methanol (PubChem CID 121456194) has the molecular formula C22H16BrN3O and a molecular weight of 418.29 g/mol. Its IUPAC name is (4-bromophenyl)-(4,6-diphenyl-1,3,5-triazin-2-yl)methanol.
| Compound Name | (4-bromophenyl)-(4,6-diphenyl-1,3,5-triazin-2-yl)methanol |
|---|---|
| PubChem CID | 121456194 |
| Molecular Formula | C22H16BrN3O |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | (4-bromophenyl)-(4,6-diphenyl-1,3,5-triazin-2-yl)methanol |
| SMILES | OC(c1ccc(Br)cc1)c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C22H16BrN3O/c23-18-13-11-15(12-14-18)19(27)22-25-20(16-7-3-1-4-8-16)24-21(26-22)17-9-5-2-6-10-17/h1-14,19,27H |
| InChIKey | NGLSUDUDPPVBAJ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |