C25H16BrN3 — CID 126701419
2-(4-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine (PubChem CID 126701419) has the molecular formula C25H16BrN3 and a molecular weight of 438.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 126701419 |
| Molecular Formula | C25H16BrN3 |
| Molecular Weight | 438.33 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 2-(4-bromophenyl)-4-naphthalen-2-yl-6-phenyl-1,3,5-triazine |
| SMILES | Brc1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4ccccc4c3)n2)cc1 |
| InChI | InChI=1S/C25H16BrN3/c26-22-14-12-19(13-15-22)24-27-23(18-7-2-1-3-8-18)28-25(29-24)21-11-10-17-6-4-5-9-20(17)16-21/h1-16H |
| InChIKey | MXNOODHQWGMJOR-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.33 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |