C13H11BrO — CID 131667546
(4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanol (PubChem CID 131667546) has the molecular formula C13H11BrO and a molecular weight of 268.16 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanol.
| Compound Name | (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanol |
|---|---|
| PubChem CID | 131667546 |
| Molecular Formula | C13H11BrO |
| Molecular Weight | 268.16 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | (4-bromophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanol |
| SMILES | [2H]c1c([2H])c([2H])c(C(O)c2ccc(Br)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C13H11BrO/c14-12-8-6-11(7-9-12)13(15)10-4-2-1-3-5-10/h1-9,13,15H/i1D,2D,3D,4D,5D |
| InChIKey | WTIWDBNPPSHSCB-RALIUCGRSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |