C13H12O — CID 10261907
(R)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethanol (PubChem CID 10261907) has the molecular formula C13H12O and a molecular weight of 189.27 g/mol. Its IUPAC name is (R)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethanol.
| Compound Name | (R)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethanol |
|---|---|
| PubChem CID | 10261907 |
| Molecular Formula | C13H12O |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (R)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethanol |
| SMILES | [2H]c1c([2H])c([2H])c([C@H](O)c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C13H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H/i1D,3D,4D,7D,8D/t13-/m0/s1 |
| InChIKey | QILSFLSDHQAZET-VCJTZVAKSA-N |
| XLogP | 2.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |