C10H11Cl3NNaO — CID 70257808
sodium;hydride;2-phenylethyl 2,2,2-trichloroethanimidate (PubChem CID 70257808) has the molecular formula C10H11Cl3NNaO and a molecular weight of 290.55 g/mol. Its IUPAC name is sodium;hydride;2-phenylethyl 2,2,2-trichloroethanimidate.
| Compound Name | sodium;hydride;2-phenylethyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 70257808 |
| Molecular Formula | C10H11Cl3NNaO |
| Molecular Weight | 290.55 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | sodium;hydride;2-phenylethyl 2,2,2-trichloroethanimidate |
| SMILES | [H-].[H]/N=C(\OCCc1ccccc1)C(Cl)(Cl)Cl.[Na+] |
| InChI | InChI=1S/C10H10Cl3NO.Na.H/c11-10(12,13)9(14)15-7-6-8-4-2-1-3-5-8;;/h1-5,14H,6-7H2;;/q;+1;-1/b14-9-;; |
| InChIKey | NFUWDVPBQKXNAU-SLYOBIJPSA-N |
| XLogP | 0.71 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|