About carbamothioic S-acid;O-(2-phenylethyl) carbamothioate
carbamothioic S-acid;O-(2-phenylethyl) carbamothioate (PubChem CID 118658866) has the molecular formula C10H14N2O2S2
and a molecular weight of 258.37 g/mol. Its IUPAC name is carbamothioic S-acid;O-(2-phenylethyl) carbamothioate.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-(2-phenylethyl) carbamothioate |
| PubChem CID | 118658866 |
| Molecular Formula | C10H14N2O2S2 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | carbamothioic S-acid;O-(2-phenylethyl) carbamothioate |
| SMILES | NC(=O)S.NC(=S)OCCc1ccccc1 |
| InChI | InChI=1S/C9H11NOS.CH3NOS/c10-9(12)11-7-6-8-4-2-1-3-5-8;2-1(3)4/h1-5H,6-7H2,(H2,10,12);(H3,2,3,4) |
| InChIKey | UESBUXJXFCRWKN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-(2-phenylethyl) carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-(2-phenylethyl) carbamothioate?
The IUPAC name of carbamothioic S-acid;O-(2-phenylethyl) carbamothioate (CID 118658866) is carbamothioic S-acid;O-(2-phenylethyl) carbamothioate.
What is the SMILES notation for carbamothioic S-acid;O-(2-phenylethyl) carbamothioate?
The canonical SMILES for carbamothioic S-acid;O-(2-phenylethyl) carbamothioate is NC(=O)S.NC(=S)OCCc1ccccc1.
What is the InChIKey of carbamothioic S-acid;O-(2-phenylethyl) carbamothioate?
The InChIKey is UESBUXJXFCRWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NOS.CH3NOS/c10-9(12)11-7-6-8-4-2-1-3-5-8;2-1(3)4/h1-5H,6-7H2,(H2,10,12);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-(2-phenylethyl) carbamothioate?
carbamothioic S-acid;O-(2-phenylethyl) carbamothioate has a molecular weight of 258.37 g/mol, XLogP of 1.48, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-(2-phenylethyl) carbamothioate is sourced from PubChem (CID 118658866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).