About 2-phenylethyl N-carbamoylcarbamate
2-phenylethyl N-carbamoylcarbamate (PubChem CID 3027882) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 2-phenylethyl N-carbamoylcarbamate.
Molecular Properties
| Compound Name | 2-phenylethyl N-carbamoylcarbamate |
| PubChem CID | 3027882 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 2-phenylethyl N-carbamoylcarbamate |
| SMILES | NC(=O)NC(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C10H12N2O3/c11-9(13)12-10(14)15-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,11,12,13,14) |
| InChIKey | VMXIGXJWVNCMDE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylethyl N-carbamoylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl N-carbamoylcarbamate?
The IUPAC name of 2-phenylethyl N-carbamoylcarbamate (CID 3027882) is 2-phenylethyl N-carbamoylcarbamate.
What is the SMILES notation for 2-phenylethyl N-carbamoylcarbamate?
The canonical SMILES for 2-phenylethyl N-carbamoylcarbamate is NC(=O)NC(=O)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl N-carbamoylcarbamate?
The InChIKey is VMXIGXJWVNCMDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3/c11-9(13)12-10(14)15-7-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H3,11,12,13,14).
What are the key properties of 2-phenylethyl N-carbamoylcarbamate?
2-phenylethyl N-carbamoylcarbamate has a molecular weight of 208.22 g/mol, XLogP of 1.03, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl N-carbamoylcarbamate is sourced from PubChem (CID 3027882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).