About carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene
carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene (PubChem CID 88720103) has the molecular formula C13H19ClN2O2S2
and a molecular weight of 334.89 g/mol. Its IUPAC name is carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene.
Molecular Properties
| Compound Name | carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene |
| PubChem CID | 88720103 |
| Molecular Formula | C13H19ClN2O2S2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene |
| SMILES | C=C(Cl)COC(N)=S.CCc1ccccc1.NC(=O)S |
| InChI | InChI=1S/C8H10.C4H6ClNOS.CH3NOS/c1-2-8-6-4-3-5-7-8;1-3(5)2-7-4(6)8;2-1(3)4/h3-7H,2H2,1H3;1-2H2,(H2,6,8);(H3,2,3,4) |
| InChIKey | XGRUVHLRTSRXFQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene?
The IUPAC name of carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene (CID 88720103) is carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene.
What is the SMILES notation for carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene?
The canonical SMILES for carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene is C=C(Cl)COC(N)=S.CCc1ccccc1.NC(=O)S.
What is the InChIKey of carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene?
The InChIKey is XGRUVHLRTSRXFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10.C4H6ClNOS.CH3NOS/c1-2-8-6-4-3-5-7-8;1-3(5)2-7-4(6)8;2-1(3)4/h3-7H,2H2,1H3;1-2H2,(H2,6,8);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene?
carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene has a molecular weight of 334.89 g/mol, XLogP of 3.24, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;O-(2-chloroprop-2-enyl) carbamothioate;ethylbenzene is sourced from PubChem (CID 88720103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).