C21H22Cl3NO10 — CID 175180158
2-[(2S,3S,4S,5R,6R)-3,5-bis(carboxymethyl)-2-phenylmethoxycarbonyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]acetic acid (PubChem CID 175180158) has the molecular formula C21H22Cl3NO10 and a molecular weight of 554.76 g/mol. Its IUPAC name is 2-[(2S,3S,4S,5R,6R)-3,5-bis(carboxymethyl)-2-phenylmethoxycarbonyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]acetic acid.
| Compound Name | 2-[(2S,3S,4S,5R,6R)-3,5-bis(carboxymethyl)-2-phenylmethoxycarbonyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 175180158 |
| Molecular Formula | C21H22Cl3NO10 |
| Molecular Weight | 554.76 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 2-[(2S,3S,4S,5R,6R)-3,5-bis(carboxymethyl)-2-phenylmethoxycarbonyl-6-(2,2,2-trichloroethanimidoyl)oxyoxan-4-yl]acetic acid |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](C(=O)OCc2ccccc2)[C@@H](CC(=O)O)[C@H](CC(=O)O)[C@H]1CC(=O)O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C21H22Cl3NO10/c22-21(23,24)20(25)35-19-13(8-16(30)31)11(6-14(26)27)12(7-15(28)29)17(34-19)18(32)33-9-10-4-2-1-3-5-10/h1-5,11-13,17,19,25H,6-9H2,(H,26,27)(H,28,29)(H,30,31)/b25-20+/t11-,12-,13+,17-,19+/m0/s1 |
| InChIKey | BJLVYEWBAIFBAG-QUSUXDOOSA-N |
| XLogP | 3.09 |
| TPSA | 180.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|