C13H14Cl3NO3 — CID 70676368
[(E)-4-hydroxy-4-(4-methoxyphenyl)but-2-enyl] 2,2,2-trichloroethanimidate (PubChem CID 70676368) has the molecular formula C13H14Cl3NO3 and a molecular weight of 338.62 g/mol. Its IUPAC name is [(E)-4-hydroxy-4-(4-methoxyphenyl)but-2-enyl] 2,2,2-trichloroethanimidate.
| Compound Name | [(E)-4-hydroxy-4-(4-methoxyphenyl)but-2-enyl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 70676368 |
| Molecular Formula | C13H14Cl3NO3 |
| Molecular Weight | 338.62 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | [(E)-4-hydroxy-4-(4-methoxyphenyl)but-2-enyl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC/C=C/C(O)c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3NO3/c1-19-10-6-4-9(5-7-10)11(18)3-2-8-20-12(17)13(14,15)16/h2-7,11,17-18H,8H2,1H3/b3-2+,17-12+ |
| InChIKey | NIONGGXGMIBIIU-FJRPBXJISA-N |
| XLogP | 3.65 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|