C11H10Cl3NO3 — CID 100983929
[4-[(2,2,2-trichloroethanimidoyl)oxymethyl]phenyl] acetate (PubChem CID 100983929) has the molecular formula C11H10Cl3NO3 and a molecular weight of 310.56 g/mol. Its IUPAC name is [4-[(2,2,2-trichloroethanimidoyl)oxymethyl]phenyl] acetate.
| Compound Name | [4-[(2,2,2-trichloroethanimidoyl)oxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 100983929 |
| Molecular Formula | C11H10Cl3NO3 |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 308.97 |
| IUPAC Name | [4-[(2,2,2-trichloroethanimidoyl)oxymethyl]phenyl] acetate |
| SMILES | [H]/N=C(\OCc1ccc(OC(C)=O)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl3NO3/c1-7(16)18-9-4-2-8(3-5-9)6-17-10(15)11(12,13)14/h2-5,15H,6H2,1H3/b15-10- |
| InChIKey | FYENRENIKAZHKH-GDNBJRDFSA-N |
| XLogP | 3.48 |
| TPSA | 59.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|