C17H17NO3S — CID 154605991
[4-[(4-methylphenyl)carbamothioyloxymethyl]phenyl] acetate (PubChem CID 154605991) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is [4-[(4-methylphenyl)carbamothioyloxymethyl]phenyl] acetate.
| Compound Name | [4-[(4-methylphenyl)carbamothioyloxymethyl]phenyl] acetate |
|---|---|
| PubChem CID | 154605991 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | [4-[(4-methylphenyl)carbamothioyloxymethyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(COC(=S)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-12-3-7-15(8-4-12)18-17(22)20-11-14-5-9-16(10-6-14)21-13(2)19/h3-10H,11H2,1-2H3,(H,18,22) |
| InChIKey | VPJUQEDCYPNUAK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|