About O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate
O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate (PubChem CID 901822) has the molecular formula C14H12ClNOS
and a molecular weight of 277.78 g/mol. Its IUPAC name is O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate.
Molecular Properties
| Compound Name | O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate |
| PubChem CID | 901822 |
| Molecular Formula | C14H12ClNOS |
| Molecular Weight | 277.78 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate |
| SMILES | Cc1ccc(OC(=S)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C14H12ClNOS/c1-10-2-8-13(9-3-10)17-14(18)16-12-6-4-11(15)5-7-12/h2-9H,1H3,(H,16,18) |
| InChIKey | JIGBJVHYEQTADP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.78 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate?
The IUPAC name of O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate (CID 901822) is O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate.
What is the SMILES notation for O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate?
The canonical SMILES for O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate is Cc1ccc(OC(=S)Nc2ccc(Cl)cc2)cc1.
What is the InChIKey of O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate?
The InChIKey is JIGBJVHYEQTADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12ClNOS/c1-10-2-8-13(9-3-10)17-14(18)16-12-6-4-11(15)5-7-12/h2-9H,1H3,(H,16,18).
What are the key properties of O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate?
O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate has a molecular weight of 277.78 g/mol, XLogP of 4.42, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-(4-methylphenyl) N-(4-chlorophenyl)carbamothioate is sourced from PubChem (CID 901822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).