C18H21Cl3O3 — CID 174660732
methoxymethane;1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene (PubChem CID 174660732) has the molecular formula C18H21Cl3O3 and a molecular weight of 391.72 g/mol. Its IUPAC name is methoxymethane;1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene.
| Compound Name | methoxymethane;1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 174660732 |
| Molecular Formula | C18H21Cl3O3 |
| Molecular Weight | 391.72 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | methoxymethane;1-methoxy-4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]benzene |
| SMILES | COC.COc1ccc(C(c2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3O2.C2H6O/c1-20-13-7-3-11(4-8-13)15(16(17,18)19)12-5-9-14(21-2)10-6-12;1-3-2/h3-10,15H,1-2H3;1-2H3 |
| InChIKey | HONPOJNRGGACPC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.72 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|