C9H11ClF2N2O — CID 105265477
[2-chloro-2,2-difluoro-1-(4-methoxyphenyl)ethyl]hydrazine (PubChem CID 105265477) has the molecular formula C9H11ClF2N2O and a molecular weight of 236.65 g/mol. Its IUPAC name is [2-chloro-2,2-difluoro-1-(4-methoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-chloro-2,2-difluoro-1-(4-methoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265477 |
| Molecular Formula | C9H11ClF2N2O |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | [2-chloro-2,2-difluoro-1-(4-methoxyphenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(NN)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C9H11ClF2N2O/c1-15-7-4-2-6(3-5-7)8(14-13)9(10,11)12/h2-5,8,14H,13H2,1H3 |
| InChIKey | RIIBEKHZOYBZAX-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|