C10H13ClF2N2O2 — CID 105265581
[2-chloro-1-(3,5-dimethoxyphenyl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265581) has the molecular formula C10H13ClF2N2O2 and a molecular weight of 266.68 g/mol. Its IUPAC name is [2-chloro-1-(3,5-dimethoxyphenyl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [2-chloro-1-(3,5-dimethoxyphenyl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265581 |
| Molecular Formula | C10H13ClF2N2O2 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | [2-chloro-1-(3,5-dimethoxyphenyl)-2,2-difluoroethyl]hydrazine |
| SMILES | COc1cc(OC)cc(C(NN)C(F)(F)Cl)c1 |
| InChI | InChI=1S/C10H13ClF2N2O2/c1-16-7-3-6(4-8(5-7)17-2)9(15-14)10(11,12)13/h3-5,9,15H,14H2,1-2H3 |
| InChIKey | URVOKZLNGCMBAM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|