C8H7ClF4N2 — CID 105265461
[2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethyl]hydrazine (PubChem CID 105265461) has the molecular formula C8H7ClF4N2 and a molecular weight of 242.60 g/mol. Its IUPAC name is [2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethyl]hydrazine.
| Compound Name | [2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethyl]hydrazine |
|---|---|
| PubChem CID | 105265461 |
| Molecular Formula | C8H7ClF4N2 |
| Molecular Weight | 242.60 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | [2-chloro-1-(3,4-difluorophenyl)-2,2-difluoroethyl]hydrazine |
| SMILES | NNC(c1ccc(F)c(F)c1)C(F)(F)Cl |
| InChI | InChI=1S/C8H7ClF4N2/c9-8(12,13)7(15-14)4-1-2-5(10)6(11)3-4/h1-3,7,15H,14H2 |
| InChIKey | SRPLYBXZUFMLNQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|