C9H10ClF3N2O — CID 105265555
[2-chloro-2,2-difluoro-1-(3-fluoro-4-methoxyphenyl)ethyl]hydrazine (PubChem CID 105265555) has the molecular formula C9H10ClF3N2O and a molecular weight of 254.64 g/mol. Its IUPAC name is [2-chloro-2,2-difluoro-1-(3-fluoro-4-methoxyphenyl)ethyl]hydrazine.
| Compound Name | [2-chloro-2,2-difluoro-1-(3-fluoro-4-methoxyphenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105265555 |
| Molecular Formula | C9H10ClF3N2O |
| Molecular Weight | 254.64 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | [2-chloro-2,2-difluoro-1-(3-fluoro-4-methoxyphenyl)ethyl]hydrazine |
| SMILES | COc1ccc(C(NN)C(F)(F)Cl)cc1F |
| InChI | InChI=1S/C9H10ClF3N2O/c1-16-7-3-2-5(4-6(7)11)8(15-14)9(10,12)13/h2-4,8,15H,14H2,1H3 |
| InChIKey | MIAORXXOVYOGDZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.64 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|