C9H7ClF4O — CID 61085047
4-(1-chloro-2,2,2-trifluoroethyl)-2-fluoro-1-methoxybenzene (PubChem CID 61085047) has the molecular formula C9H7ClF4O and a molecular weight of 242.60 g/mol. Its IUPAC name is 4-(1-chloro-2,2,2-trifluoroethyl)-2-fluoro-1-methoxybenzene.
| Compound Name | 4-(1-chloro-2,2,2-trifluoroethyl)-2-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 61085047 |
| Molecular Formula | C9H7ClF4O |
| Molecular Weight | 242.60 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 4-(1-chloro-2,2,2-trifluoroethyl)-2-fluoro-1-methoxybenzene |
| SMILES | COc1ccc(C(Cl)C(F)(F)F)cc1F |
| InChI | InChI=1S/C9H7ClF4O/c1-15-7-3-2-5(4-6(7)11)8(10)9(12,13)14/h2-4,8H,1H3 |
| InChIKey | ZNXLNDGFZXQASC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|