C14H23F2N3 — CID 105239288
1-(3,4-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine (PubChem CID 105239288) has the molecular formula C14H23F2N3 and a molecular weight of 271.35 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine.
| Compound Name | 1-(3,4-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 105239288 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 1-(3,4-difluorophenyl)-N,N-diethyl-1-hydrazinyl-2-methylpropan-2-amine |
| SMILES | CCN(CC)C(C)(C)C(NN)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H23F2N3/c1-5-19(6-2)14(3,4)13(18-17)10-7-8-11(15)12(16)9-10/h7-9,13,18H,5-6,17H2,1-4H3 |
| InChIKey | RMEQDKAOTAMHEP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|