C12H17F3N2O — CID 105305314
[2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propyl]hydrazine (PubChem CID 105305314) has the molecular formula C12H17F3N2O and a molecular weight of 262.28 g/mol. Its IUPAC name is [2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propyl]hydrazine.
| Compound Name | [2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propyl]hydrazine |
|---|---|
| PubChem CID | 105305314 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | [2,2-dimethyl-1-[4-(trifluoromethoxy)phenyl]propyl]hydrazine |
| SMILES | CC(C)(C)C(NN)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H17F3N2O/c1-11(2,3)10(17-16)8-4-6-9(7-5-8)18-12(13,14)15/h4-7,10,17H,16H2,1-3H3 |
| InChIKey | YLGDYEPDZDGNMW-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|