C17H16F6N2O2 — CID 166838574
N'-methyl-1,2-bis[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine (PubChem CID 166838574) has the molecular formula C17H16F6N2O2 and a molecular weight of 394.32 g/mol. Its IUPAC name is N'-methyl-1,2-bis[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-1,2-bis[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 166838574 |
| Molecular Formula | C17H16F6N2O2 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N'-methyl-1,2-bis[4-(trifluoromethoxy)phenyl]ethane-1,2-diamine |
| SMILES | CNC(c1ccc(OC(F)(F)F)cc1)C(N)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F6N2O2/c1-25-15(11-4-8-13(9-5-11)27-17(21,22)23)14(24)10-2-6-12(7-3-10)26-16(18,19)20/h2-9,14-15,25H,24H2,1H3 |
| InChIKey | QCYRKRDIGWDNNI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |