C18H21Cl3O4 — CID 175290818
methoxymethane;[4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]phenoxy]methanol (PubChem CID 175290818) has the molecular formula C18H21Cl3O4 and a molecular weight of 407.72 g/mol. Its IUPAC name is methoxymethane;[4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]phenoxy]methanol.
| Compound Name | methoxymethane;[4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]phenoxy]methanol |
|---|---|
| PubChem CID | 175290818 |
| Molecular Formula | C18H21Cl3O4 |
| Molecular Weight | 407.72 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | methoxymethane;[4-[2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]phenoxy]methanol |
| SMILES | COC.COc1ccc(C(c2ccc(OCO)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H15Cl3O3.C2H6O/c1-21-13-6-2-11(3-7-13)15(16(17,18)19)12-4-8-14(9-5-12)22-10-20;1-3-2/h2-9,15,20H,10H2,1H3;1-2H3 |
| InChIKey | SQCYEWJHIXGPRE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|