C17H18Cl3NO2 — CID 53426653
4-methoxy-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline (PubChem CID 53426653) has the molecular formula C17H18Cl3NO2 and a molecular weight of 374.70 g/mol. Its IUPAC name is 4-methoxy-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline.
| Compound Name | 4-methoxy-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline |
|---|---|
| PubChem CID | 53426653 |
| Molecular Formula | C17H18Cl3NO2 |
| Molecular Weight | 374.70 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-methoxy-N-[2,2,2-trichloro-1-(4-ethoxyphenyl)ethyl]aniline |
| SMILES | CCOc1ccc(C(Nc2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H18Cl3NO2/c1-3-23-15-8-4-12(5-9-15)16(17(18,19)20)21-13-6-10-14(22-2)11-7-13/h4-11,16,21H,3H2,1-2H3 |
| InChIKey | DDXOVYVCIGMZCX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|