C16H25Cl3N2O — CID 92858851
N',N'-diethyl-N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]propane-1,3-diamine (PubChem CID 92858851) has the molecular formula C16H25Cl3N2O and a molecular weight of 367.75 g/mol. Its IUPAC name is N',N'-diethyl-N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 92858851 |
| Molecular Formula | C16H25Cl3N2O |
| Molecular Weight | 367.75 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N',N'-diethyl-N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]propane-1,3-diamine |
| SMILES | CCN(CC)CCCN[C@@H](c1ccc(OC)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H25Cl3N2O/c1-4-21(5-2)12-6-11-20-15(16(17,18)19)13-7-9-14(22-3)10-8-13/h7-10,15,20H,4-6,11-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | OFRXUNGYDUXSGN-HNNXBMFYSA-N |
| XLogP | 4.43 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.75 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|