C27H32Cl2N2O — CID 21486702
N-[4-[1,2-dichloro-2-(4-methoxyphenyl)-1-phenylethyl]phenyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 21486702) has the molecular formula C27H32Cl2N2O and a molecular weight of 471.47 g/mol. Its IUPAC name is N-[4-[1,2-dichloro-2-(4-methoxyphenyl)-1-phenylethyl]phenyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[4-[1,2-dichloro-2-(4-methoxyphenyl)-1-phenylethyl]phenyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 21486702 |
| Molecular Formula | C27H32Cl2N2O |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[4-[1,2-dichloro-2-(4-methoxyphenyl)-1-phenylethyl]phenyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNc1ccc(C(Cl)(c2ccccc2)C(Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H32Cl2N2O/c1-4-31(5-2)20-19-30-24-15-13-23(14-16-24)27(29,22-9-7-6-8-10-22)26(28)21-11-17-25(32-3)18-12-21/h6-18,26,30H,4-5,19-20H2,1-3H3 |
| InChIKey | CGGXSLUSJKYASA-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|