C45H44O5 — CID 70004134
1,1,5,5-tetrakis(4-methoxyphenyl)-1,5-diphenylpentan-3-ol (PubChem CID 70004134) has the molecular formula C45H44O5 and a molecular weight of 664.84 g/mol. Its IUPAC name is 1,1,5,5-tetrakis(4-methoxyphenyl)-1,5-diphenylpentan-3-ol.
| Compound Name | 1,1,5,5-tetrakis(4-methoxyphenyl)-1,5-diphenylpentan-3-ol |
|---|---|
| PubChem CID | 70004134 |
| Molecular Formula | C45H44O5 |
| Molecular Weight | 664.84 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | 1,1,5,5-tetrakis(4-methoxyphenyl)-1,5-diphenylpentan-3-ol |
| SMILES | COc1ccc(C(CC(O)CC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C45H44O5/c1-47-40-23-15-35(16-24-40)44(33-11-7-5-8-12-33,36-17-25-41(48-2)26-18-36)31-39(46)32-45(34-13-9-6-10-14-34,37-19-27-42(49-3)28-20-37)38-21-29-43(50-4)30-22-38/h5-30,39,46H,31-32H2,1-4H3 |
| InChIKey | YZROCQKKYKHEBQ-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.84 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|