C25H26O6S — CID 88620158
2-[1-hydroxy-3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylacetaldehyde (PubChem CID 88620158) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is 2-[1-hydroxy-3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylacetaldehyde.
| Compound Name | 2-[1-hydroxy-3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylacetaldehyde |
|---|---|
| PubChem CID | 88620158 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 2-[1-hydroxy-3,3-bis(4-methoxyphenyl)-3-phenylpropyl]sulfonylacetaldehyde |
| SMILES | COc1ccc(C(CC(O)S(=O)(=O)CC=O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H26O6S/c1-30-22-12-8-20(9-13-22)25(19-6-4-3-5-7-19,18-24(27)32(28,29)17-16-26)21-10-14-23(31-2)15-11-21/h3-16,24,27H,17-18H2,1-2H3 |
| InChIKey | JBMPDWFLFASYPV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|